C10H16N4O2S — CID 113479631
4-amino-5-methyl-N-(1-oxothian-4-yl)-1H-pyrazole-3-carboxamide (PubChem CID 113479631) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-amino-5-methyl-N-(1-oxothian-4-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-5-methyl-N-(1-oxothian-4-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 113479631 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-amino-5-methyl-N-(1-oxothian-4-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC2CCS(=O)CC2)c1N |
| InChI | InChI=1S/C10H16N4O2S/c1-6-8(11)9(14-13-6)10(15)12-7-2-4-17(16)5-3-7/h7H,2-5,11H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | XPNOUGCNSRJBMK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |