C14H26N2OS — CID 113480590
4-(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)thiane 1-oxide (PubChem CID 113480590) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 4-(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)thiane 1-oxide.
| Compound Name | 4-(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)thiane 1-oxide |
|---|---|
| PubChem CID | 113480590 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-(8-methyl-6,9-diazaspiro[4.5]decan-9-yl)thiane 1-oxide |
| SMILES | CC1CNC2(CCCC2)CN1C1CCS(=O)CC1 |
| InChI | InChI=1S/C14H26N2OS/c1-12-10-15-14(6-2-3-7-14)11-16(12)13-4-8-18(17)9-5-13/h12-13,15H,2-11H2,1H3 |
| InChIKey | MMBLSGMNTBCCIN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |