C18H35N3 — CID 64946301
8-ethyl-9-(1-propylpiperidin-4-yl)-6,9-diazaspiro[4.5]decane (PubChem CID 64946301) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 8-ethyl-9-(1-propylpiperidin-4-yl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-(1-propylpiperidin-4-yl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64946301 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 8-ethyl-9-(1-propylpiperidin-4-yl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCCN1CCC(N2CC3(CCCC3)NCC2CC)CC1 |
| InChI | InChI=1S/C18H35N3/c1-3-11-20-12-7-17(8-13-20)21-15-18(9-5-6-10-18)19-14-16(21)4-2/h16-17,19H,3-15H2,1-2H3 |
| InChIKey | OWSXASKIDCKJBZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |