C18H34N2 — CID 64934961
9-(2-cyclohexylethyl)-8-ethyl-6,9-diazaspiro[4.5]decane (PubChem CID 64934961) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 9-(2-cyclohexylethyl)-8-ethyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 9-(2-cyclohexylethyl)-8-ethyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64934961 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 9-(2-cyclohexylethyl)-8-ethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCCC2)CN1CCC1CCCCC1 |
| InChI | InChI=1S/C18H34N2/c1-2-17-14-19-18(11-6-7-12-18)15-20(17)13-10-16-8-4-3-5-9-16/h16-17,19H,2-15H2,1H3 |
| InChIKey | SLRLATUKYXCCEI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |