C15H30N2O2S — CID 106733186
3-ethyl-4-(2-ethylsulfonylethyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 106733186) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is 3-ethyl-4-(2-ethylsulfonylethyl)-1,4-diazaspiro[5.5]undecane.
| Compound Name | 3-ethyl-4-(2-ethylsulfonylethyl)-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 106733186 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-ethyl-4-(2-ethylsulfonylethyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | CCC1CNC2(CCCCC2)CN1CCS(=O)(=O)CC |
| InChI | InChI=1S/C15H30N2O2S/c1-3-14-12-16-15(8-6-5-7-9-15)13-17(14)10-11-20(18,19)4-2/h14,16H,3-13H2,1-2H3 |
| InChIKey | DMXJJIHAGZJSSA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |