C16H32N2 — CID 64878514
8-ethyl-9-hexyl-6,9-diazaspiro[4.5]decane (PubChem CID 64878514) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 8-ethyl-9-hexyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-hexyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64878514 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 8-ethyl-9-hexyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCCCCN1CC2(CCCC2)NCC1CC |
| InChI | InChI=1S/C16H32N2/c1-3-5-6-9-12-18-14-16(10-7-8-11-16)17-13-15(18)4-2/h15,17H,3-14H2,1-2H3 |
| InChIKey | HZJSPTPFKUCBFW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|