C18H36N2 — CID 64946256
8-ethyl-9-octan-2-yl-6,9-diazaspiro[4.5]decane (PubChem CID 64946256) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 8-ethyl-9-octan-2-yl-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-octan-2-yl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64946256 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 8-ethyl-9-octan-2-yl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCCCCC(C)N1CC2(CCCC2)NCC1CC |
| InChI | InChI=1S/C18H36N2/c1-4-6-7-8-11-16(3)20-15-18(12-9-10-13-18)19-14-17(20)5-2/h16-17,19H,4-15H2,1-3H3 |
| InChIKey | OHHLDVPDWOOYMU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|