C15H26N2 — CID 106224522
8-ethyl-9-pent-1-yn-3-yl-6,9-diazaspiro[4.5]decane (PubChem CID 106224522) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 8-ethyl-9-pent-1-yn-3-yl-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-pent-1-yn-3-yl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 106224522 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 8-ethyl-9-pent-1-yn-3-yl-6,9-diazaspiro[4.5]decane |
| SMILES | C#CC(CC)N1CC2(CCCC2)NCC1CC |
| InChI | InChI=1S/C15H26N2/c1-4-13(5-2)17-12-15(9-7-8-10-15)16-11-14(17)6-3/h1,13-14,16H,5-12H2,2-3H3 |
| InChIKey | GWHUBAGGIHTPJB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|