C14H13FN2S — CID 113481612
5-[[[(1R)-1-(2-fluorophenyl)ethyl]amino]methyl]thiophene-2-carbonitrile (PubChem CID 113481612) has the molecular formula C14H13FN2S and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-[[[(1R)-1-(2-fluorophenyl)ethyl]amino]methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[[[(1R)-1-(2-fluorophenyl)ethyl]amino]methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 113481612 |
| Molecular Formula | C14H13FN2S |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-[[[(1R)-1-(2-fluorophenyl)ethyl]amino]methyl]thiophene-2-carbonitrile |
| SMILES | C[C@@H](NCc1ccc(C#N)s1)c1ccccc1F |
| InChI | InChI=1S/C14H13FN2S/c1-10(13-4-2-3-5-14(13)15)17-9-12-7-6-11(8-16)18-12/h2-7,10,17H,9H2,1H3/t10-/m1/s1 |
| InChIKey | ONHINYLAEKCJGF-SNVBAGLBSA-N |
| XLogP | 3.61 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |