C10H11N3S — CID 104586907
5-[(1-cyanopropan-2-ylamino)methyl]thiophene-2-carbonitrile (PubChem CID 104586907) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 5-[(1-cyanopropan-2-ylamino)methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[(1-cyanopropan-2-ylamino)methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 104586907 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-[(1-cyanopropan-2-ylamino)methyl]thiophene-2-carbonitrile |
| SMILES | CC(CC#N)NCc1ccc(C#N)s1 |
| InChI | InChI=1S/C10H11N3S/c1-8(4-5-11)13-7-10-3-2-9(6-12)14-10/h2-3,8,13H,4,7H2,1H3 |
| InChIKey | DRESMLORSYWRHY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |