C11H16N2S2 — CID 115675962
5-[(1-ethylsulfanylpropan-2-ylamino)methyl]thiophene-2-carbonitrile (PubChem CID 115675962) has the molecular formula C11H16N2S2 and a molecular weight of 240.40 g/mol. Its IUPAC name is 5-[(1-ethylsulfanylpropan-2-ylamino)methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[(1-ethylsulfanylpropan-2-ylamino)methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115675962 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 5-[(1-ethylsulfanylpropan-2-ylamino)methyl]thiophene-2-carbonitrile |
| SMILES | CCSCC(C)NCc1ccc(C#N)s1 |
| InChI | InChI=1S/C11H16N2S2/c1-3-14-8-9(2)13-7-11-5-4-10(6-12)15-11/h4-5,9,13H,3,7-8H2,1-2H3 |
| InChIKey | AUTFHRPDNHHLDS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |