C12H16N2S — CID 115675866
5-[(1-cyclopropylpropan-2-ylamino)methyl]thiophene-2-carbonitrile (PubChem CID 115675866) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 5-[(1-cyclopropylpropan-2-ylamino)methyl]thiophene-2-carbonitrile.
| Compound Name | 5-[(1-cyclopropylpropan-2-ylamino)methyl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 115675866 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-[(1-cyclopropylpropan-2-ylamino)methyl]thiophene-2-carbonitrile |
| SMILES | CC(CC1CC1)NCc1ccc(C#N)s1 |
| InChI | InChI=1S/C12H16N2S/c1-9(6-10-2-3-10)14-8-12-5-4-11(7-13)15-12/h4-5,9-10,14H,2-3,6,8H2,1H3 |
| InChIKey | NCUAYODPLPQDER-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |