C11H10F3N3O — CID 113482617
1-[1-(2,4,5-trifluorophenyl)triazol-4-yl]propan-1-ol (PubChem CID 113482617) has the molecular formula C11H10F3N3O and a molecular weight of 257.22 g/mol. Its IUPAC name is 1-[1-(2,4,5-trifluorophenyl)triazol-4-yl]propan-1-ol.
| Compound Name | 1-[1-(2,4,5-trifluorophenyl)triazol-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 113482617 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-[1-(2,4,5-trifluorophenyl)triazol-4-yl]propan-1-ol |
| SMILES | CCC(O)c1cn(-c2cc(F)c(F)cc2F)nn1 |
| InChI | InChI=1S/C11H10F3N3O/c1-2-11(18)9-5-17(16-15-9)10-4-7(13)6(12)3-8(10)14/h3-5,11,18H,2H2,1H3 |
| InChIKey | ZUYILWPMTRNZKG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|