C15H12N8S — CID 11348277
4-methyl-3-(13-methyl-8,10,12,15,16-pentazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaen-14-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 11348277) has the molecular formula C15H12N8S and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-methyl-3-(13-methyl-8,10,12,15,16-pentazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaen-14-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-methyl-3-(13-methyl-8,10,12,15,16-pentazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaen-14-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11348277 |
| Molecular Formula | C15H12N8S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-methyl-3-(13-methyl-8,10,12,15,16-pentazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaen-14-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc2n(nc3c4ccccc4ncn32)c1-c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C15H12N8S/c1-8-11(13-18-19-15(24)21(13)2)23-14(17-8)22-7-16-10-6-4-3-5-9(10)12(22)20-23/h3-7H,1-2H3,(H,19,24) |
| InChIKey | DAVCGIQSXYURCE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|