C22H22N4S — CID 27520431
3-[2-[4-[(2S)-butan-2-yl]phenyl]quinolin-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 27520431) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 3-[2-[4-[(2S)-butan-2-yl]phenyl]quinolin-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-[4-[(2S)-butan-2-yl]phenyl]quinolin-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 27520431 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[2-[4-[(2S)-butan-2-yl]phenyl]quinolin-4-yl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CC[C@H](C)c1ccc(-c2cc(-c3n[nH]c(=S)n3C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H22N4S/c1-4-14(2)15-9-11-16(12-10-15)20-13-18(21-24-25-22(27)26(21)3)17-7-5-6-8-19(17)23-20/h5-14H,4H2,1-3H3,(H,25,27)/t14-/m0/s1 |
| InChIKey | RIVVEWNIRXJYDF-AWEZNQCLSA-N |
| XLogP | 5.87 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|