C30H22N4OS — CID 44758620
4-(2-methoxy-5-phenylphenyl)-3-(2-phenylquinolin-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 44758620) has the molecular formula C30H22N4OS and a molecular weight of 486.60 g/mol. Its IUPAC name is 4-(2-methoxy-5-phenylphenyl)-3-(2-phenylquinolin-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methoxy-5-phenylphenyl)-3-(2-phenylquinolin-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 44758620 |
| Molecular Formula | C30H22N4OS |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-(2-methoxy-5-phenylphenyl)-3-(2-phenylquinolin-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-c2ccccc2)cc1-n1c(-c2cc(-c3ccccc3)nc3ccccc23)n[nH]c1=S |
| InChI | InChI=1S/C30H22N4OS/c1-35-28-17-16-22(20-10-4-2-5-11-20)18-27(28)34-29(32-33-30(34)36)24-19-26(21-12-6-3-7-13-21)31-25-15-9-8-14-23(24)25/h2-19H,1H3,(H,33,36) |
| InChIKey | NTAXOWPIAZSXTQ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|