C13H11ClN4S — CID 82449126
3-(6-chloro-2-methylquinolin-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 82449126) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 3-(6-chloro-2-methylquinolin-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(6-chloro-2-methylquinolin-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 82449126 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-(6-chloro-2-methylquinolin-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2C)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C13H11ClN4S/c1-7-5-10(12-16-17-13(19)18(12)2)9-6-8(14)3-4-11(9)15-7/h3-6H,1-2H3,(H,17,19) |
| InChIKey | MVDJVJJXCHXQJI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|