C18H20N6O — CID 11348280
N-[1-[6-(tert-butylamino)pyrimidin-4-yl]benzimidazol-5-yl]prop-2-enamide (PubChem CID 11348280) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is N-[1-[6-(tert-butylamino)pyrimidin-4-yl]benzimidazol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[6-(tert-butylamino)pyrimidin-4-yl]benzimidazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11348280 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[1-[6-(tert-butylamino)pyrimidin-4-yl]benzimidazol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)ncn2-c1cc(NC(C)(C)C)ncn1 |
| InChI | InChI=1S/C18H20N6O/c1-5-17(25)22-12-6-7-14-13(8-12)21-11-24(14)16-9-15(19-10-20-16)23-18(2,3)4/h5-11H,1H2,2-4H3,(H,22,25)(H,19,20,23) |
| InChIKey | GAAAFIJWQSHFTJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|