C21H21N5O — CID 168992031
1-[6-[5-[[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-2-yl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanone (PubChem CID 168992031) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[6-[5-[[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-2-yl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[6-[5-[[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-2-yl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 168992031 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[6-[5-[[(2E,4Z)-5-(methylideneamino)hexa-2,4-dien-2-yl]amino]benzimidazol-1-yl]-3-pyridinyl]ethanone |
| SMILES | C=N/C(C)=C\C=C(/C)Nc1ccc2c(c1)ncn2-c1ccc(C(C)=O)cn1 |
| InChI | InChI=1S/C21H21N5O/c1-14(22-4)5-6-15(2)25-18-8-9-20-19(11-18)24-13-26(20)21-10-7-17(12-23-21)16(3)27/h5-13,25H,4H2,1-3H3/b14-5-,15-6+ |
| InChIKey | BRBLYOZWVIZBSR-YOENDLTHSA-N |
| XLogP | 4.54 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|