C12H18N2O4 — CID 113483116
5-methyl-3-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-1H-pyrrole-2-carboxylic acid (PubChem CID 113483116) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-methyl-3-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-methyl-3-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 113483116 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 5-methyl-3-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NC(=O)COC(C)(C)C)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C12H18N2O4/c1-7-5-8(10(13-7)11(16)17)14-9(15)6-18-12(2,3)4/h5,13H,6H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | XBWZUQRXHSEGTL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |