C12H19N3O4 — CID 113483193
3-[(3-methoxy-2-methylpropyl)carbamoylamino]-5-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 113483193) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[(3-methoxy-2-methylpropyl)carbamoylamino]-5-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(3-methoxy-2-methylpropyl)carbamoylamino]-5-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 113483193 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[(3-methoxy-2-methylpropyl)carbamoylamino]-5-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | COCC(C)CNC(=O)Nc1cc(C)[nH]c1C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-7(6-19-3)5-13-12(18)15-9-4-8(2)14-10(9)11(16)17/h4,7,14H,5-6H2,1-3H3,(H,16,17)(H2,13,15,18) |
| InChIKey | NTWRSYJZDQHFBW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |