C13H20ClFN2O — CID 113484777
3-[[2-amino-1-(2-chloro-6-fluorophenyl)ethyl]amino]-2-methylbutan-1-ol (PubChem CID 113484777) has the molecular formula C13H20ClFN2O and a molecular weight of 274.77 g/mol. Its IUPAC name is 3-[[2-amino-1-(2-chloro-6-fluorophenyl)ethyl]amino]-2-methylbutan-1-ol.
| Compound Name | 3-[[2-amino-1-(2-chloro-6-fluorophenyl)ethyl]amino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 113484777 |
| Molecular Formula | C13H20ClFN2O |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-[[2-amino-1-(2-chloro-6-fluorophenyl)ethyl]amino]-2-methylbutan-1-ol |
| SMILES | CC(CO)C(C)NC(CN)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H20ClFN2O/c1-8(7-18)9(2)17-12(6-16)13-10(14)4-3-5-11(13)15/h3-5,8-9,12,17-18H,6-7,16H2,1-2H3 |
| InChIKey | LXPJXAPYTWZBPJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |