C12H14Cl2N2 — CID 114416192
N-but-3-yn-2-yl-1-(2,6-dichlorophenyl)ethane-1,2-diamine (PubChem CID 114416192) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-(2,6-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | N-but-3-yn-2-yl-1-(2,6-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114416192 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-but-3-yn-2-yl-1-(2,6-dichlorophenyl)ethane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2/c1-3-8(2)16-11(7-15)12-9(13)5-4-6-10(12)14/h1,4-6,8,11,16H,7,15H2,2H3 |
| InChIKey | DUYXQPFRJMJELU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|