C15H22N2O3 — CID 114415989
N-but-3-yn-2-yl-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine (PubChem CID 114415989) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-but-3-yn-2-yl-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114415989 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-but-3-yn-2-yl-1-(2,4,6-trimethoxyphenyl)ethane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-6-10(2)17-12(9-16)15-13(19-4)7-11(18-3)8-14(15)20-5/h1,7-8,10,12,17H,9,16H2,2-5H3 |
| InChIKey | AOUDQZHHCNITSU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|