C12H18N2S — CID 114415852
N-but-3-yn-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine (PubChem CID 114415852) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine.
| Compound Name | N-but-3-yn-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114415852 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-but-3-yn-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)c1cc(C)sc1C |
| InChI | InChI=1S/C12H18N2S/c1-5-8(2)14-12(7-13)11-6-9(3)15-10(11)4/h1,6,8,12,14H,7,13H2,2-4H3 |
| InChIKey | RLGUMUCZAMFZIV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|