C14H20N2 — CID 114415987
N-but-3-yn-2-yl-1-(3,5-dimethylphenyl)ethane-1,2-diamine (PubChem CID 114415987) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-(3,5-dimethylphenyl)ethane-1,2-diamine.
| Compound Name | N-but-3-yn-2-yl-1-(3,5-dimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114415987 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-but-3-yn-2-yl-1-(3,5-dimethylphenyl)ethane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H20N2/c1-5-12(4)16-14(9-15)13-7-10(2)6-11(3)8-13/h1,6-8,12,14,16H,9,15H2,2-4H3 |
| InChIKey | PQEXLPCBAUBKEV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|