C16H24N2 — CID 106228296
1-(3,5-dimethylphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine (PubChem CID 106228296) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106228296 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H24N2/c1-5-7-15(6-2)18-16(11-17)14-9-12(3)8-13(4)10-14/h2,8-10,15-16,18H,5,7,11,17H2,1,3-4H3 |
| InChIKey | SRMHFRRRTRZRFV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|