C14H21N3 — CID 114161073
N-hex-1-yn-3-yl-1-(4-methyl-3-pyridinyl)ethane-1,2-diamine (PubChem CID 114161073) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-1-(4-methyl-3-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-hex-1-yn-3-yl-1-(4-methyl-3-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114161073 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | N-hex-1-yn-3-yl-1-(4-methyl-3-pyridinyl)ethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1cnccc1C |
| InChI | InChI=1S/C14H21N3/c1-4-6-12(5-2)17-14(9-15)13-10-16-8-7-11(13)3/h2,7-8,10,12,14,17H,4,6,9,15H2,1,3H3 |
| InChIKey | YFGBWTLCMONGLU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|