C16H24N2O2 — CID 106228264
1-(2,3-dimethoxyphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine (PubChem CID 106228264) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine.
| Compound Name | 1-(2,3-dimethoxyphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106228264 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1cccc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O2/c1-5-8-12(6-2)18-14(11-17)13-9-7-10-15(19-3)16(13)20-4/h2,7,9-10,12,14,18H,5,8,11,17H2,1,3-4H3 |
| InChIKey | FGCKVPCVMCXSTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|