C14H18BrFN2 — CID 114161092
1-(2-bromo-5-fluorophenyl)-N-hex-1-yn-3-ylethane-1,2-diamine (PubChem CID 114161092) has the molecular formula C14H18BrFN2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-N-hex-1-yn-3-ylethane-1,2-diamine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 114161092 |
| Molecular Formula | C14H18BrFN2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-N-hex-1-yn-3-ylethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1cc(F)ccc1Br |
| InChI | InChI=1S/C14H18BrFN2/c1-3-5-11(4-2)18-14(9-17)12-8-10(16)6-7-13(12)15/h2,6-8,11,14,18H,3,5,9,17H2,1H3 |
| InChIKey | MQBJKUWPHPSCHR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|