C13H22N4 — CID 106227949
1-(3-ethylimidazol-4-yl)-N-hex-1-yn-3-ylethane-1,2-diamine (PubChem CID 106227949) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1-(3-ethylimidazol-4-yl)-N-hex-1-yn-3-ylethane-1,2-diamine.
| Compound Name | 1-(3-ethylimidazol-4-yl)-N-hex-1-yn-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106227949 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-(3-ethylimidazol-4-yl)-N-hex-1-yn-3-ylethane-1,2-diamine |
| SMILES | C#CC(CCC)NC(CN)c1cncn1CC |
| InChI | InChI=1S/C13H22N4/c1-4-7-11(5-2)16-12(8-14)13-9-15-10-17(13)6-3/h2,9-12,16H,4,6-8,14H2,1,3H3 |
| InChIKey | NSSGBWDRDCQBEC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|