C10H20N4O — CID 66133270
1-(3-ethylimidazol-4-yl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 66133270) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-(3-ethylimidazol-4-yl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | 1-(3-ethylimidazol-4-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66133270 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 1-(3-ethylimidazol-4-yl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCn1cncc1C(CN)NCCOC |
| InChI | InChI=1S/C10H20N4O/c1-3-14-8-12-7-10(14)9(6-11)13-4-5-15-2/h7-9,13H,3-6,11H2,1-2H3 |
| InChIKey | NSXXQDMYBKJNQD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|