C11H14N2 — CID 105315594
1-(3,5-dimethylphenyl)prop-2-ynylhydrazine (PubChem CID 105315594) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)prop-2-ynylhydrazine.
| Compound Name | 1-(3,5-dimethylphenyl)prop-2-ynylhydrazine |
|---|---|
| PubChem CID | 105315594 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(3,5-dimethylphenyl)prop-2-ynylhydrazine |
| SMILES | C#CC(NN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C11H14N2/c1-4-11(13-12)10-6-8(2)5-9(3)7-10/h1,5-7,11,13H,12H2,2-3H3 |
| InChIKey | FMDATALFEIBNIZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|