C12H20N2O2 — CID 105246161
[1-(3,5-dimethylphenyl)-2,2-dimethoxyethyl]hydrazine (PubChem CID 105246161) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is [1-(3,5-dimethylphenyl)-2,2-dimethoxyethyl]hydrazine.
| Compound Name | [1-(3,5-dimethylphenyl)-2,2-dimethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105246161 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | [1-(3,5-dimethylphenyl)-2,2-dimethoxyethyl]hydrazine |
| SMILES | COC(OC)C(NN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H20N2O2/c1-8-5-9(2)7-10(6-8)11(14-13)12(15-3)16-4/h5-7,11-12,14H,13H2,1-4H3 |
| InChIKey | JOWBYQNCQXUBJN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|