C12H19NO2 — CID 79493345
2,2-dimethoxy-N-methyl-1-(3-methylphenyl)ethanamine (PubChem CID 79493345) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,2-dimethoxy-N-methyl-1-(3-methylphenyl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-methyl-1-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 79493345 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2,2-dimethoxy-N-methyl-1-(3-methylphenyl)ethanamine |
| SMILES | CNC(c1cccc(C)c1)C(OC)OC |
| InChI | InChI=1S/C12H19NO2/c1-9-6-5-7-10(8-9)11(13-2)12(14-3)15-4/h5-8,11-13H,1-4H3 |
| InChIKey | GGPFEDYZKNXNPY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|