C10H17NO2S — CID 79492752
2,2-dimethoxy-N-methyl-1-(5-methylthiophen-3-yl)ethanamine (PubChem CID 79492752) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,2-dimethoxy-N-methyl-1-(5-methylthiophen-3-yl)ethanamine.
| Compound Name | 2,2-dimethoxy-N-methyl-1-(5-methylthiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 79492752 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2,2-dimethoxy-N-methyl-1-(5-methylthiophen-3-yl)ethanamine |
| SMILES | CNC(c1csc(C)c1)C(OC)OC |
| InChI | InChI=1S/C10H17NO2S/c1-7-5-8(6-14-7)9(11-2)10(12-3)13-4/h5-6,9-11H,1-4H3 |
| InChIKey | ODUHDBYQIPKVBY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|