C12H21NOS — CID 79616237
2-methoxy-1-(5-methylthiophen-3-yl)-N-propylpropan-1-amine (PubChem CID 79616237) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 2-methoxy-1-(5-methylthiophen-3-yl)-N-propylpropan-1-amine.
| Compound Name | 2-methoxy-1-(5-methylthiophen-3-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79616237 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-methoxy-1-(5-methylthiophen-3-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(c1csc(C)c1)C(C)OC |
| InChI | InChI=1S/C12H21NOS/c1-5-6-13-12(10(3)14-4)11-7-9(2)15-8-11/h7-8,10,12-13H,5-6H2,1-4H3 |
| InChIKey | UAUIACFNUMMENY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |