C14H18N2O2 — CID 105245972
(2,2-dimethoxy-1-naphthalen-2-ylethyl)hydrazine (PubChem CID 105245972) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2,2-dimethoxy-1-naphthalen-2-ylethyl)hydrazine.
| Compound Name | (2,2-dimethoxy-1-naphthalen-2-ylethyl)hydrazine |
|---|---|
| PubChem CID | 105245972 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2,2-dimethoxy-1-naphthalen-2-ylethyl)hydrazine |
| SMILES | COC(OC)C(NN)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-17-14(18-2)13(16-15)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13-14,16H,15H2,1-2H3 |
| InChIKey | SLDKVHAMBYTTDT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|