C30H36N2 — CID 15472052
(1R,2S)-N,N'-ditert-butyl-1,2-dinaphthalen-2-ylethane-1,2-diamine (PubChem CID 15472052) has the molecular formula C30H36N2 and a molecular weight of 424.63 g/mol. Its IUPAC name is (1R,2S)-N,N'-ditert-butyl-1,2-dinaphthalen-2-ylethane-1,2-diamine.
| Compound Name | (1R,2S)-N,N'-ditert-butyl-1,2-dinaphthalen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 15472052 |
| Molecular Formula | C30H36N2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | (1R,2S)-N,N'-ditert-butyl-1,2-dinaphthalen-2-ylethane-1,2-diamine |
| SMILES | CC(C)(C)N[C@H](c1ccc2ccccc2c1)[C@@H](NC(C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H36N2/c1-29(2,3)31-27(25-17-15-21-11-7-9-13-23(21)19-25)28(32-30(4,5)6)26-18-16-22-12-8-10-14-24(22)20-26/h7-20,27-28,31-32H,1-6H3/t27-,28+ |
| InChIKey | MCQADZHLJYQARZ-HNRBIFIRSA-N |
| XLogP | 7.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |