C13H17BrFNO — CID 113484913
2-(5-bromo-2-fluorophenyl)-5,6-dimethyl-1,4-oxazepane (PubChem CID 113484913) has the molecular formula C13H17BrFNO and a molecular weight of 302.19 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-5,6-dimethyl-1,4-oxazepane.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-5,6-dimethyl-1,4-oxazepane |
|---|---|
| PubChem CID | 113484913 |
| Molecular Formula | C13H17BrFNO |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-5,6-dimethyl-1,4-oxazepane |
| SMILES | CC1COC(c2cc(Br)ccc2F)CNC1C |
| InChI | InChI=1S/C13H17BrFNO/c1-8-7-17-13(6-16-9(8)2)11-5-10(14)3-4-12(11)15/h3-5,8-9,13,16H,6-7H2,1-2H3 |
| InChIKey | XCHCMBQYPVPORW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |