C11H10ClN3O2S — CID 113486866
2-chloro-5-nitro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 113486866) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 2-chloro-5-nitro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 113486866 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-5-nitro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | CC(Nc1cc([N+](=O)[O-])ccc1Cl)c1cscn1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-7(11-5-18-6-13-11)14-10-4-8(15(16)17)2-3-9(10)12/h2-7,14H,1H3 |
| InChIKey | UXURMYWDEALUER-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|