C12H14N2O2S2 — CID 113486874
3-[1-(1,3-thiazol-4-yl)ethylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 113486874) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[1-(1,3-thiazol-4-yl)ethylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[1-(1,3-thiazol-4-yl)ethylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 113486874 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-[1-(1,3-thiazol-4-yl)ethylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | CC(NC(CC(=O)O)c1cccs1)c1cscn1 |
| InChI | InChI=1S/C12H14N2O2S2/c1-8(10-6-17-7-13-10)14-9(5-12(15)16)11-3-2-4-18-11/h2-4,6-9,14H,5H2,1H3,(H,15,16) |
| InChIKey | MHDLHUAJSQRJGB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |