C8H7NOS2 — CID 78923935
1,3-thiazol-4-yl(thiophen-2-yl)methanol (PubChem CID 78923935) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,3-thiazol-4-yl(thiophen-2-yl)methanol.
| Compound Name | 1,3-thiazol-4-yl(thiophen-2-yl)methanol |
|---|---|
| PubChem CID | 78923935 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 1,3-thiazol-4-yl(thiophen-2-yl)methanol |
| SMILES | OC(c1cscn1)c1cccs1 |
| InChI | InChI=1S/C8H7NOS2/c10-8(6-4-11-5-9-6)7-2-1-3-12-7/h1-5,8,10H |
| InChIKey | KWWQYTIDADZNAP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |