C4H5NO2S — CID 59870088
1,3-thiazol-4-ylmethanediol (PubChem CID 59870088) has the molecular formula C4H5NO2S and a molecular weight of 131.16 g/mol. Its IUPAC name is 1,3-thiazol-4-ylmethanediol.
| Compound Name | 1,3-thiazol-4-ylmethanediol |
|---|---|
| PubChem CID | 59870088 |
| Molecular Formula | C4H5NO2S |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.00 |
| IUPAC Name | 1,3-thiazol-4-ylmethanediol |
| SMILES | OC(O)c1cscn1 |
| InChI | InChI=1S/C4H5NO2S/c6-4(7)3-1-8-2-5-3/h1-2,4,6-7H |
| InChIKey | GIZDOMQPWSDZIA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|