About 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine
2-fluoro-1-(1,3-thiazol-4-yl)ethanamine (PubChem CID 83815268) has the molecular formula C5H7FN2S
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine |
| PubChem CID | 83815268 |
| Molecular Formula | C5H7FN2S |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine |
| SMILES | NC(CF)c1cscn1 |
| InChI | InChI=1S/C5H7FN2S/c6-1-4(7)5-2-9-3-8-5/h2-4H,1,7H2 |
| InChIKey | BKVYXKYJBFZDOS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine?
The IUPAC name of 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine (CID 83815268) is 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine.
What is the SMILES notation for 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine?
The canonical SMILES for 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine is NC(CF)c1cscn1.
What is the InChIKey of 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine?
The InChIKey is BKVYXKYJBFZDOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2S/c6-1-4(7)5-2-9-3-8-5/h2-4H,1,7H2.
What are the key properties of 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine?
2-fluoro-1-(1,3-thiazol-4-yl)ethanamine has a molecular weight of 146.19 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-(1,3-thiazol-4-yl)ethanamine is sourced from PubChem (CID 83815268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).