4-amino-4-(1,3-thiazol-4-yl)butanoic acid

C7H10N2O2S — CID 82602298

IUPAC4-amino-4-(1,3-thiazol-4-yl)butanoic acid
SMILESNC(CCC(=O)O)c1cscn1
InChIInChI=1S/C7H10N2O2S/c8-5(1-2-7(10)11)6-3-12-4-9-6/h3-5H,1-2,8H2,(H,10,11)
InChIKeyBDMJIKPTFGDJCN-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.01
Rot. Bonds4

About 4-amino-4-(1,3-thiazol-4-yl)butanoic acid

4-amino-4-(1,3-thiazol-4-yl)butanoic acid (PubChem CID 82602298) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 4-amino-4-(1,3-thiazol-4-yl)butanoic acid.

Molecular Properties

Compound Name4-amino-4-(1,3-thiazol-4-yl)butanoic acid
PubChem CID82602298
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name4-amino-4-(1,3-thiazol-4-yl)butanoic acid
SMILESNC(CCC(=O)O)c1cscn1
InChIInChI=1S/C7H10N2O2S/c8-5(1-2-7(10)11)6-3-12-4-9-6/h3-5H,1-2,8H2,(H,10,11)
InChIKeyBDMJIKPTFGDJCN-UHFFFAOYSA-N
XLogP1.01
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-amino-4-(1,3-thiazol-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-4-(1,3-thiazol-4-yl)butanoic acid?
The IUPAC name of 4-amino-4-(1,3-thiazol-4-yl)butanoic acid (CID 82602298) is 4-amino-4-(1,3-thiazol-4-yl)butanoic acid.
What is the SMILES notation for 4-amino-4-(1,3-thiazol-4-yl)butanoic acid?
The canonical SMILES for 4-amino-4-(1,3-thiazol-4-yl)butanoic acid is NC(CCC(=O)O)c1cscn1.
What is the InChIKey of 4-amino-4-(1,3-thiazol-4-yl)butanoic acid?
The InChIKey is BDMJIKPTFGDJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c8-5(1-2-7(10)11)6-3-12-4-9-6/h3-5H,1-2,8H2,(H,10,11).
What are the key properties of 4-amino-4-(1,3-thiazol-4-yl)butanoic acid?
4-amino-4-(1,3-thiazol-4-yl)butanoic acid has a molecular weight of 186.24 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-4-(1,3-thiazol-4-yl)butanoic acid is sourced from PubChem (CID 82602298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).