C7H11N3O2S — CID 13389287
2-(2-aminoethylamino)-2-(1,3-thiazol-4-yl)acetic acid (PubChem CID 13389287) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-2-(1,3-thiazol-4-yl)acetic acid.
| Compound Name | 2-(2-aminoethylamino)-2-(1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 13389287 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(2-aminoethylamino)-2-(1,3-thiazol-4-yl)acetic acid |
| SMILES | NCCNC(C(=O)O)c1cscn1 |
| InChI | InChI=1S/C7H11N3O2S/c8-1-2-9-6(7(11)12)5-3-13-4-10-5/h3-4,6,9H,1-2,8H2,(H,11,12) |
| InChIKey | MEGGNKBFTLJTHN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |