C5H7FN2S — CID 131156691
2-fluoro-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 131156691) has the molecular formula C5H7FN2S and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-fluoro-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | 2-fluoro-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 131156691 |
| Molecular Formula | C5H7FN2S |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | 2-fluoro-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | NCC(F)c1cscn1 |
| InChI | InChI=1S/C5H7FN2S/c6-4(1-7)5-2-9-3-8-5/h2-4H,1,7H2 |
| InChIKey | YTHSAZLAOVYMTL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |