About N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine
N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine (PubChem CID 83819523) has the molecular formula C9H15FN2S
and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine |
| PubChem CID | 83819523 |
| Molecular Formula | C9H15FN2S |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNC(CF)c1cscn1 |
| InChI | InChI=1S/C9H15FN2S/c1-7(2)4-11-8(3-10)9-5-13-6-12-9/h5-8,11H,3-4H2,1-2H3 |
| InChIKey | FTHSPSBRFJCNHQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine?
The IUPAC name of N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine (CID 83819523) is N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine.
What is the SMILES notation for N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine?
The canonical SMILES for N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine is CC(C)CNC(CF)c1cscn1.
What is the InChIKey of N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine?
The InChIKey is FTHSPSBRFJCNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN2S/c1-7(2)4-11-8(3-10)9-5-13-6-12-9/h5-8,11H,3-4H2,1-2H3.
What are the key properties of N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine?
N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine has a molecular weight of 202.30 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-1-(1,3-thiazol-4-yl)ethyl]-2-methylpropan-1-amine is sourced from PubChem (CID 83819523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).