C12H12N4S3 — CID 122628350
1,2,3-tris(1,3-thiazol-4-yl)propan-1-amine (PubChem CID 122628350) has the molecular formula C12H12N4S3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 1,2,3-tris(1,3-thiazol-4-yl)propan-1-amine.
| Compound Name | 1,2,3-tris(1,3-thiazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 122628350 |
| Molecular Formula | C12H12N4S3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1,2,3-tris(1,3-thiazol-4-yl)propan-1-amine |
| SMILES | NC(c1cscn1)C(Cc1cscn1)c1cscn1 |
| InChI | InChI=1S/C12H12N4S3/c13-12(11-4-19-7-16-11)9(10-3-18-6-15-10)1-8-2-17-5-14-8/h2-7,9,12H,1,13H2 |
| InChIKey | KBUIROLLSTYKRT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |